About 2-benzylbenzoate
2-benzylbenzoate (PubChem CID 6951338) has the molecular formula C14H11O2-
and a molecular weight of 211.24 g/mol. Its IUPAC name is 2-benzylbenzoate.
Molecular Properties
| Compound Name | 2-benzylbenzoate |
| PubChem CID | 6951338 |
| Molecular Formula | C14H11O2- |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 2-benzylbenzoate |
| SMILES | O=C([O-])c1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C14H12O2/c15-14(16)13-9-5-4-8-12(13)10-11-6-2-1-3-7-11/h1-9H,10H2,(H,15,16)/p-1 |
| InChIKey | FESDHLLVLYZNFY-UHFFFAOYSA-M |
| XLogP | 1.64 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-benzylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylbenzoate?
The IUPAC name of 2-benzylbenzoate (CID 6951338) is 2-benzylbenzoate.
What is the SMILES notation for 2-benzylbenzoate?
The canonical SMILES for 2-benzylbenzoate is O=C([O-])c1ccccc1Cc1ccccc1.
What is the InChIKey of 2-benzylbenzoate?
The InChIKey is FESDHLLVLYZNFY-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H12O2/c15-14(16)13-9-5-4-8-12(13)10-11-6-2-1-3-7-11/h1-9H,10H2,(H,15,16)/p-1.
What are the key properties of 2-benzylbenzoate?
2-benzylbenzoate has a molecular weight of 211.24 g/mol, XLogP of 1.64, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylbenzoate is sourced from PubChem (CID 6951338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).