C5H13NO2 — CID 6951533
(2R)-3-(dimethylamino)propane-1,2-diol (PubChem CID 6951533) has the molecular formula C5H13NO2 and a molecular weight of 119.16 g/mol. Its IUPAC name is (2R)-3-(dimethylamino)propane-1,2-diol.
| Compound Name | (2R)-3-(dimethylamino)propane-1,2-diol |
|---|---|
| PubChem CID | 6951533 |
| Molecular Formula | C5H13NO2 |
| Molecular Weight | 119.16 g/mol |
| Exact Mass | 119.09 |
| IUPAC Name | (2R)-3-(dimethylamino)propane-1,2-diol |
| SMILES | CN(C)C[C@@H](O)CO |
| InChI | InChI=1S/C5H13NO2/c1-6(2)3-5(8)4-7/h5,7-8H,3-4H2,1-2H3/t5-/m1/s1 |
| InChIKey | QCMHUGYTOGXZIW-RXMQYKEDSA-N |
| XLogP | -1.10 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 119.16 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |