C19H15N3O2S — CID 695162
N-(4-imidazo[1,2-a]pyridin-2-ylphenyl)benzenesulfonamide (PubChem CID 695162) has the molecular formula C19H15N3O2S and a molecular weight of 349.42 g/mol. Its IUPAC name is N-(4-imidazo[1,2-a]pyridin-2-ylphenyl)benzenesulfonamide.
| Compound Name | N-(4-imidazo[1,2-a]pyridin-2-ylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 695162 |
| Molecular Formula | C19H15N3O2S |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | N-(4-imidazo[1,2-a]pyridin-2-ylphenyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(-c2cn3ccccc3n2)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H15N3O2S/c23-25(24,17-6-2-1-3-7-17)21-16-11-9-15(10-12-16)18-14-22-13-5-4-8-19(22)20-18/h1-14,21H |
| InChIKey | COYHVIRIHZJRRJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |