C18H15N3O3 — CID 695183
(E)-4-[3-(7-methylimidazo[1,2-a]pyridin-2-yl)anilino]-4-oxobut-2-enoic acid (PubChem CID 695183) has the molecular formula C18H15N3O3 and a molecular weight of 321.34 g/mol. Its IUPAC name is (E)-4-[3-(7-methylimidazo[1,2-a]pyridin-2-yl)anilino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[3-(7-methylimidazo[1,2-a]pyridin-2-yl)anilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 695183 |
| Molecular Formula | C18H15N3O3 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | (E)-4-[3-(7-methylimidazo[1,2-a]pyridin-2-yl)anilino]-4-oxobut-2-enoic acid |
| SMILES | Cc1ccn2cc(-c3cccc(NC(=O)/C=C/C(=O)O)c3)nc2c1 |
| InChI | InChI=1S/C18H15N3O3/c1-12-7-8-21-11-15(20-16(21)9-12)13-3-2-4-14(10-13)19-17(22)5-6-18(23)24/h2-11H,1H3,(H,19,22)(H,23,24)/b6-5+ |
| InChIKey | AOVSGNOLGXKMQZ-AATRIKPKSA-N |
| XLogP | 2.89 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|