About 2-chloro-1,3,5-trinitrobenzene
2-chloro-1,3,5-trinitrobenzene (PubChem CID 6953) has the molecular formula C6H2ClN3O6
and a molecular weight of 247.55 g/mol. Its IUPAC name is 2-chloro-1,3,5-trinitrobenzene.
Molecular Properties
| Compound Name | 2-chloro-1,3,5-trinitrobenzene |
| PubChem CID | 6953 |
| Molecular Formula | C6H2ClN3O6 |
| Molecular Weight | 247.55 g/mol |
| Exact Mass | 246.96 |
| IUPAC Name | 2-chloro-1,3,5-trinitrobenzene |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C6H2ClN3O6/c7-6-4(9(13)14)1-3(8(11)12)2-5(6)10(15)16/h1-2H |
| InChIKey | HJRJRUMKQCMYDL-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 129.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.55 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1,3,5-trinitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1,3,5-trinitrobenzene?
The IUPAC name of 2-chloro-1,3,5-trinitrobenzene (CID 6953) is 2-chloro-1,3,5-trinitrobenzene.
What is the SMILES notation for 2-chloro-1,3,5-trinitrobenzene?
The canonical SMILES for 2-chloro-1,3,5-trinitrobenzene is O=[N+]([O-])c1cc([N+](=O)[O-])c(Cl)c([N+](=O)[O-])c1.
What is the InChIKey of 2-chloro-1,3,5-trinitrobenzene?
The InChIKey is HJRJRUMKQCMYDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2ClN3O6/c7-6-4(9(13)14)1-3(8(11)12)2-5(6)10(15)16/h1-2H.
What are the key properties of 2-chloro-1,3,5-trinitrobenzene?
2-chloro-1,3,5-trinitrobenzene has a molecular weight of 247.55 g/mol, XLogP of 2.06, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1,3,5-trinitrobenzene is sourced from PubChem (CID 6953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).