About (2S)-2-(azaniumylmethyl)-4-methyl-2,3-dihydrofuro[3,2-c]quinoline-8-carboxylate
(2S)-2-(azaniumylmethyl)-4-methyl-2,3-dihydrofuro[3,2-c]quinoline-8-carboxylate (PubChem CID 6954728) has the molecular formula C14H14N2O3
and a molecular weight of 258.28 g/mol. Its IUPAC name is (2S)-2-(azaniumylmethyl)-4-methyl-2,3-dihydrofuro[3,2-c]quinoline-8-carboxylate.
Molecular Properties
| Compound Name | (2S)-2-(azaniumylmethyl)-4-methyl-2,3-dihydrofuro[3,2-c]quinoline-8-carboxylate |
| PubChem CID | 6954728 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | (2S)-2-(azaniumylmethyl)-4-methyl-2,3-dihydrofuro[3,2-c]quinoline-8-carboxylate |
| SMILES | Cc1nc2ccc(C(=O)[O-])cc2c2c1C[C@@H](C[NH3+])O2 |
| InChI | InChI=1S/C14H14N2O3/c1-7-10-5-9(6-15)19-13(10)11-4-8(14(17)18)2-3-12(11)16-7/h2-4,9H,5-6,15H2,1H3,(H,17,18)/t9-/m0/s1 |
| InChIKey | XLPIRLQSGFVQRP-VIFPVBQESA-N |
| XLogP | -0.55 |
| TPSA | 89.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-(azaniumylmethyl)-4-methyl-2,3-dihydrofuro[3,2-c]quinoline-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(azaniumylmethyl)-4-methyl-2,3-dihydrofuro[3,2-c]quinoline-8-carboxylate?
The IUPAC name of (2S)-2-(azaniumylmethyl)-4-methyl-2,3-dihydrofuro[3,2-c]quinoline-8-carboxylate (CID 6954728) is (2S)-2-(azaniumylmethyl)-4-methyl-2,3-dihydrofuro[3,2-c]quinoline-8-carboxylate.
What is the SMILES notation for (2S)-2-(azaniumylmethyl)-4-methyl-2,3-dihydrofuro[3,2-c]quinoline-8-carboxylate?
The canonical SMILES for (2S)-2-(azaniumylmethyl)-4-methyl-2,3-dihydrofuro[3,2-c]quinoline-8-carboxylate is Cc1nc2ccc(C(=O)[O-])cc2c2c1C[C@@H](C[NH3+])O2.
What is the InChIKey of (2S)-2-(azaniumylmethyl)-4-methyl-2,3-dihydrofuro[3,2-c]quinoline-8-carboxylate?
The InChIKey is XLPIRLQSGFVQRP-VIFPVBQESA-N. The full InChI is InChI=1S/C14H14N2O3/c1-7-10-5-9(6-15)19-13(10)11-4-8(14(17)18)2-3-12(11)16-7/h2-4,9H,5-6,15H2,1H3,(H,17,18)/t9-/m0/s1.
What are the key properties of (2S)-2-(azaniumylmethyl)-4-methyl-2,3-dihydrofuro[3,2-c]quinoline-8-carboxylate?
(2S)-2-(azaniumylmethyl)-4-methyl-2,3-dihydrofuro[3,2-c]quinoline-8-carboxylate has a molecular weight of 258.28 g/mol, XLogP of -0.55, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(azaniumylmethyl)-4-methyl-2,3-dihydrofuro[3,2-c]quinoline-8-carboxylate is sourced from PubChem (CID 6954728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).