C18H18NO3- — CID 6955755
2-[4-[[(2S)-2-phenylbutanoyl]amino]phenyl]acetate (PubChem CID 6955755) has the molecular formula C18H18NO3- and a molecular weight of 296.35 g/mol. Its IUPAC name is 2-[4-[[(2S)-2-phenylbutanoyl]amino]phenyl]acetate.
| Compound Name | 2-[4-[[(2S)-2-phenylbutanoyl]amino]phenyl]acetate |
|---|---|
| PubChem CID | 6955755 |
| Molecular Formula | C18H18NO3- |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 2-[4-[[(2S)-2-phenylbutanoyl]amino]phenyl]acetate |
| SMILES | CC[C@H](C(=O)Nc1ccc(CC(=O)[O-])cc1)c1ccccc1 |
| InChI | InChI=1S/C18H19NO3/c1-2-16(14-6-4-3-5-7-14)18(22)19-15-10-8-13(9-11-15)12-17(20)21/h3-11,16H,2,12H2,1H3,(H,19,22)(H,20,21)/p-1/t16-/m0/s1 |
| InChIKey | AZXSGBRXFNAKHI-INIZCTEOSA-M |
| XLogP | 2.11 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |