C16H24N4O4 — CID 6955787
5-[C-ethyl-N-(2-morpholin-4-ylethyl)carbonimidoyl]-1-prop-2-enyl-1,3-diazinane-2,4,6-trione (PubChem CID 6955787) has the molecular formula C16H24N4O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is 5-[C-ethyl-N-(2-morpholin-4-ylethyl)carbonimidoyl]-1-prop-2-enyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[C-ethyl-N-(2-morpholin-4-ylethyl)carbonimidoyl]-1-prop-2-enyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 6955787 |
| Molecular Formula | C16H24N4O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 5-[C-ethyl-N-(2-morpholin-4-ylethyl)carbonimidoyl]-1-prop-2-enyl-1,3-diazinane-2,4,6-trione |
| SMILES | C=CCN1C(=O)NC(=O)C(/C(CC)=N/CCN2CCOCC2)C1=O |
| InChI | InChI=1S/C16H24N4O4/c1-3-6-20-15(22)13(14(21)18-16(20)23)12(4-2)17-5-7-19-8-10-24-11-9-19/h3,13H,1,4-11H2,2H3,(H,18,21,23)/b17-12+ |
| InChIKey | ZVQSZGUYYRPBGW-SFQUDFHCSA-N |
| XLogP | 0.05 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|