C14H25N2O3- — CID 6956248
(2S)-2-[[(2S)-2-ethylpiperidine-1-carbonyl]amino]-4-methylpentanoate (PubChem CID 6956248) has the molecular formula C14H25N2O3- and a molecular weight of 269.36 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-ethylpiperidine-1-carbonyl]amino]-4-methylpentanoate.
| Compound Name | (2S)-2-[[(2S)-2-ethylpiperidine-1-carbonyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 6956248 |
| Molecular Formula | C14H25N2O3- |
| Molecular Weight | 269.36 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | (2S)-2-[[(2S)-2-ethylpiperidine-1-carbonyl]amino]-4-methylpentanoate |
| SMILES | CC[C@H]1CCCCN1C(=O)N[C@@H](CC(C)C)C(=O)[O-] |
| InChI | InChI=1S/C14H26N2O3/c1-4-11-7-5-6-8-16(11)14(19)15-12(13(17)18)9-10(2)3/h10-12H,4-9H2,1-3H3,(H,15,19)(H,17,18)/p-1/t11-,12-/m0/s1 |
| InChIKey | ASABHDOMTTZJIO-RYUDHWBXSA-M |
| XLogP | 1.13 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.36 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |