About 5-(2,4-dichlorophenyl)-3-phenyl-1,2,4-oxadiazole
5-(2,4-dichlorophenyl)-3-phenyl-1,2,4-oxadiazole (PubChem CID 695652) has the molecular formula C14H8Cl2N2O
and a molecular weight of 291.14 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-3-phenyl-1,2,4-oxadiazole.
Molecular Properties
| Compound Name | 5-(2,4-dichlorophenyl)-3-phenyl-1,2,4-oxadiazole |
| PubChem CID | 695652 |
| Molecular Formula | C14H8Cl2N2O |
| Molecular Weight | 291.14 g/mol |
| Exact Mass | 290.00 |
| IUPAC Name | 5-(2,4-dichlorophenyl)-3-phenyl-1,2,4-oxadiazole |
| SMILES | Clc1ccc(-c2nc(-c3ccccc3)no2)c(Cl)c1 |
| InChI | InChI=1S/C14H8Cl2N2O/c15-10-6-7-11(12(16)8-10)14-17-13(18-19-14)9-4-2-1-3-5-9/h1-8H |
| InChIKey | WMJVJVBCUBCALD-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.14 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(2,4-dichlorophenyl)-3-phenyl-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,4-dichlorophenyl)-3-phenyl-1,2,4-oxadiazole?
The IUPAC name of 5-(2,4-dichlorophenyl)-3-phenyl-1,2,4-oxadiazole (CID 695652) is 5-(2,4-dichlorophenyl)-3-phenyl-1,2,4-oxadiazole.
What is the SMILES notation for 5-(2,4-dichlorophenyl)-3-phenyl-1,2,4-oxadiazole?
The canonical SMILES for 5-(2,4-dichlorophenyl)-3-phenyl-1,2,4-oxadiazole is Clc1ccc(-c2nc(-c3ccccc3)no2)c(Cl)c1.
What is the InChIKey of 5-(2,4-dichlorophenyl)-3-phenyl-1,2,4-oxadiazole?
The InChIKey is WMJVJVBCUBCALD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8Cl2N2O/c15-10-6-7-11(12(16)8-10)14-17-13(18-19-14)9-4-2-1-3-5-9/h1-8H.
What are the key properties of 5-(2,4-dichlorophenyl)-3-phenyl-1,2,4-oxadiazole?
5-(2,4-dichlorophenyl)-3-phenyl-1,2,4-oxadiazole has a molecular weight of 291.14 g/mol, XLogP of 4.71, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,4-dichlorophenyl)-3-phenyl-1,2,4-oxadiazole is sourced from PubChem (CID 695652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).