C10H21N6O+3 — CID 6956600
[3-(2-morpholin-4-ium-4-ylethyl)-1,2,3,4-tetrahydro-1,3,5-triazine-3,5-diium-6-yl]cyanamide (PubChem CID 6956600) has the molecular formula C10H21N6O+3 and a molecular weight of 241.32 g/mol. Its IUPAC name is [3-(2-morpholin-4-ium-4-ylethyl)-1,2,3,4-tetrahydro-1,3,5-triazine-3,5-diium-6-yl]cyanamide.
| Compound Name | [3-(2-morpholin-4-ium-4-ylethyl)-1,2,3,4-tetrahydro-1,3,5-triazine-3,5-diium-6-yl]cyanamide |
|---|---|
| PubChem CID | 6956600 |
| Molecular Formula | C10H21N6O+3 |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | [3-(2-morpholin-4-ium-4-ylethyl)-1,2,3,4-tetrahydro-1,3,5-triazine-3,5-diium-6-yl]cyanamide |
| SMILES | N#CNC1=[NH+]C[NH+](CC[NH+]2CCOCC2)CN1 |
| InChI | InChI=1S/C10H18N6O/c11-7-12-10-13-8-16(9-14-10)2-1-15-3-5-17-6-4-15/h1-6,8-9H2,(H2,12,13,14)/p+3 |
| InChIKey | WLUNUDKQTVHRPW-UHFFFAOYSA-Q |
| XLogP | -6.19 |
| TPSA | 79.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | -6.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|