About 2-Fluoroimidazo[4,5-e]quinoline
2-Fluoroimidazo[4,5-e]quinoline (PubChem CID 69566545) has the molecular formula C10H6FN3
and a molecular weight of 187.17 g/mol. Its IUPAC name is 2-fluoroimidazo[4,5-e]quinoline.
Molecular Properties
| Compound Name | 2-Fluoroimidazo[4,5-e]quinoline |
| PubChem CID | 69566545 |
| Molecular Formula | C10H6FN3 |
| Molecular Weight | 187.17 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | 2-fluoroimidazo[4,5-e]quinoline |
| SMILES | C1=CC2=NC(=NC23C=CC=NC3=C1)F |
| InChI | InChI=1S/C10H6FN3/c11-9-13-8-4-1-3-7-10(8,14-9)5-2-6-12-7/h1-6H |
| InChIKey | IYLBYNOYAKKDPS-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 37.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | 480 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.17 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-Fluoroimidazo[4,5-e]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-Fluoroimidazo[4,5-e]quinoline?
The IUPAC name of 2-Fluoroimidazo[4,5-e]quinoline (CID 69566545) is 2-fluoroimidazo[4,5-e]quinoline.
What is the SMILES notation for 2-Fluoroimidazo[4,5-e]quinoline?
The canonical SMILES for 2-Fluoroimidazo[4,5-e]quinoline is C1=CC2=NC(=NC23C=CC=NC3=C1)F.
What is the InChIKey of 2-Fluoroimidazo[4,5-e]quinoline?
The InChIKey is IYLBYNOYAKKDPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6FN3/c11-9-13-8-4-1-3-7-10(8,14-9)5-2-6-12-7/h1-6H.
What are the key properties of 2-Fluoroimidazo[4,5-e]quinoline?
2-Fluoroimidazo[4,5-e]quinoline has a molecular weight of 187.17 g/mol, XLogP of 0.70, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-Fluoroimidazo[4,5-e]quinoline is sourced from PubChem (CID 69566545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).