C18H19N2O3- — CID 6956673
(2S)-2-[[benzyl(methyl)carbamoyl]amino]-3-phenylpropanoate (PubChem CID 6956673) has the molecular formula C18H19N2O3- and a molecular weight of 311.36 g/mol. Its IUPAC name is (2S)-2-[[benzyl(methyl)carbamoyl]amino]-3-phenylpropanoate.
| Compound Name | (2S)-2-[[benzyl(methyl)carbamoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 6956673 |
| Molecular Formula | C18H19N2O3- |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | (2S)-2-[[benzyl(methyl)carbamoyl]amino]-3-phenylpropanoate |
| SMILES | CN(Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C18H20N2O3/c1-20(13-15-10-6-3-7-11-15)18(23)19-16(17(21)22)12-14-8-4-2-5-9-14/h2-11,16H,12-13H2,1H3,(H,19,23)(H,21,22)/p-1/t16-/m0/s1 |
| InChIKey | PLNXIDBQONXANV-INIZCTEOSA-M |
| XLogP | 1.19 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |