About methyl 5-oxo-1,2-dihydropyrazole-3-carboxylate
methyl 5-oxo-1,2-dihydropyrazole-3-carboxylate (PubChem CID 6957297) has the molecular formula C5H6N2O3
and a molecular weight of 142.11 g/mol. Its IUPAC name is methyl 5-oxo-1,2-dihydropyrazole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 5-oxo-1,2-dihydropyrazole-3-carboxylate |
| PubChem CID | 6957297 |
| Molecular Formula | C5H6N2O3 |
| Molecular Weight | 142.11 g/mol |
| Exact Mass | 142.04 |
| IUPAC Name | methyl 5-oxo-1,2-dihydropyrazole-3-carboxylate |
| SMILES | COC(=O)c1cc(=O)[nH][nH]1 |
| InChI | InChI=1S/C5H6N2O3/c1-10-5(9)3-2-4(8)7-6-3/h2H,1H3,(H2,6,7,8) |
| InChIKey | JTJZOTYGFHOHMK-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.11 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 5-oxo-1,2-dihydropyrazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-oxo-1,2-dihydropyrazole-3-carboxylate?
The IUPAC name of methyl 5-oxo-1,2-dihydropyrazole-3-carboxylate (CID 6957297) is methyl 5-oxo-1,2-dihydropyrazole-3-carboxylate.
What is the SMILES notation for methyl 5-oxo-1,2-dihydropyrazole-3-carboxylate?
The canonical SMILES for methyl 5-oxo-1,2-dihydropyrazole-3-carboxylate is COC(=O)c1cc(=O)[nH][nH]1.
What is the InChIKey of methyl 5-oxo-1,2-dihydropyrazole-3-carboxylate?
The InChIKey is JTJZOTYGFHOHMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O3/c1-10-5(9)3-2-4(8)7-6-3/h2H,1H3,(H2,6,7,8).
What are the key properties of methyl 5-oxo-1,2-dihydropyrazole-3-carboxylate?
methyl 5-oxo-1,2-dihydropyrazole-3-carboxylate has a molecular weight of 142.11 g/mol, XLogP of -0.51, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-oxo-1,2-dihydropyrazole-3-carboxylate is sourced from PubChem (CID 6957297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).