C21H21N5 — CID 6957627
(1S,4R,4aR)-4-[4-(dimethylamino)phenyl]-2-imino-1,4,4a,5,6,7-hexahydronaphthalene-1,3,3-tricarbonitrile (PubChem CID 6957627) has the molecular formula C21H21N5 and a molecular weight of 343.43 g/mol. Its IUPAC name is (1S,4R,4aR)-4-[4-(dimethylamino)phenyl]-2-imino-1,4,4a,5,6,7-hexahydronaphthalene-1,3,3-tricarbonitrile.
| Compound Name | (1S,4R,4aR)-4-[4-(dimethylamino)phenyl]-2-imino-1,4,4a,5,6,7-hexahydronaphthalene-1,3,3-tricarbonitrile |
|---|---|
| PubChem CID | 6957627 |
| Molecular Formula | C21H21N5 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | (1S,4R,4aR)-4-[4-(dimethylamino)phenyl]-2-imino-1,4,4a,5,6,7-hexahydronaphthalene-1,3,3-tricarbonitrile |
| SMILES | [H]/N=C1\[C@@H](C#N)C2=CCCC[C@@H]2[C@H](c2ccc(N(C)C)cc2)C1(C#N)C#N |
| InChI | InChI=1S/C21H21N5/c1-26(2)15-9-7-14(8-10-15)19-17-6-4-3-5-16(17)18(11-22)20(25)21(19,12-23)13-24/h5,7-10,17-19,25H,3-4,6H2,1-2H3/b25-20+/t17-,18-,19-/m0/s1 |
| InChIKey | CRBKHFGWPVFJSU-BSMYFJOHSA-N |
| XLogP | 3.77 |
| TPSA | 98.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|