C26H27N4O3S+ — CID 6958966
2-[(3-cyano-6-methyl-4-phenyl-5,6,7,8-tetrahydro-1,6-naphthyridin-6-ium-2-yl)sulfanyl]-N-(3,4-dimethoxyphenyl)acetamide (PubChem CID 6958966) has the molecular formula C26H27N4O3S+ and a molecular weight of 475.59 g/mol. Its IUPAC name is 2-[(3-cyano-6-methyl-4-phenyl-5,6,7,8-tetrahydro-1,6-naphthyridin-6-ium-2-yl)sulfanyl]-N-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | 2-[(3-cyano-6-methyl-4-phenyl-5,6,7,8-tetrahydro-1,6-naphthyridin-6-ium-2-yl)sulfanyl]-N-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 6958966 |
| Molecular Formula | C26H27N4O3S+ |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 2-[(3-cyano-6-methyl-4-phenyl-5,6,7,8-tetrahydro-1,6-naphthyridin-6-ium-2-yl)sulfanyl]-N-(3,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CSc2nc3c(c(-c4ccccc4)c2C#N)C[NH+](C)CC3)cc1OC |
| InChI | InChI=1S/C26H26N4O3S/c1-30-12-11-21-20(15-30)25(17-7-5-4-6-8-17)19(14-27)26(29-21)34-16-24(31)28-18-9-10-22(32-2)23(13-18)33-3/h4-10,13H,11-12,15-16H2,1-3H3,(H,28,31)/p+1 |
| InChIKey | PNSRGATYCSGFBP-UHFFFAOYSA-O |
| XLogP | 2.94 |
| TPSA | 88.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |