About 4-[5-[(4,6-dioxo-2-phenyl-1,3-dioxan-5-ylidene)methyl]furan-2-yl]-3-methylbenzoate
4-[5-[(4,6-dioxo-2-phenyl-1,3-dioxan-5-ylidene)methyl]furan-2-yl]-3-methylbenzoate (PubChem CID 6959123) has the molecular formula C23H15O7-
and a molecular weight of 403.37 g/mol. Its IUPAC name is 4-[5-[(4,6-dioxo-2-phenyl-1,3-dioxan-5-ylidene)methyl]furan-2-yl]-3-methylbenzoate.
Molecular Properties
| Compound Name | 4-[5-[(4,6-dioxo-2-phenyl-1,3-dioxan-5-ylidene)methyl]furan-2-yl]-3-methylbenzoate |
| PubChem CID | 6959123 |
| Molecular Formula | C23H15O7- |
| Molecular Weight | 403.37 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | 4-[5-[(4,6-dioxo-2-phenyl-1,3-dioxan-5-ylidene)methyl]furan-2-yl]-3-methylbenzoate |
| SMILES | Cc1cc(C(=O)[O-])ccc1-c1ccc(C=C2C(=O)OC(c3ccccc3)OC2=O)o1 |
| InChI | InChI=1S/C23H16O7/c1-13-11-15(20(24)25)7-9-17(13)19-10-8-16(28-19)12-18-21(26)29-23(30-22(18)27)14-5-3-2-4-6-14/h2-12,23H,1H3,(H,24,25)/p-1/b18-12- |
| InChIKey | BRVJEYRLPINJLX-PDGQHHTCSA-M |
| XLogP | 2.80 |
| TPSA | 105.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.37 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 4-[5-[(4,6-dioxo-2-phenyl-1,3-dioxan-5-ylidene)methyl]furan-2-yl]-3-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-[(4,6-dioxo-2-phenyl-1,3-dioxan-5-ylidene)methyl]furan-2-yl]-3-methylbenzoate?
The IUPAC name of 4-[5-[(4,6-dioxo-2-phenyl-1,3-dioxan-5-ylidene)methyl]furan-2-yl]-3-methylbenzoate (CID 6959123) is 4-[5-[(4,6-dioxo-2-phenyl-1,3-dioxan-5-ylidene)methyl]furan-2-yl]-3-methylbenzoate.
What is the SMILES notation for 4-[5-[(4,6-dioxo-2-phenyl-1,3-dioxan-5-ylidene)methyl]furan-2-yl]-3-methylbenzoate?
The canonical SMILES for 4-[5-[(4,6-dioxo-2-phenyl-1,3-dioxan-5-ylidene)methyl]furan-2-yl]-3-methylbenzoate is Cc1cc(C(=O)[O-])ccc1-c1ccc(C=C2C(=O)OC(c3ccccc3)OC2=O)o1.
What is the InChIKey of 4-[5-[(4,6-dioxo-2-phenyl-1,3-dioxan-5-ylidene)methyl]furan-2-yl]-3-methylbenzoate?
The InChIKey is BRVJEYRLPINJLX-PDGQHHTCSA-M. The full InChI is InChI=1S/C23H16O7/c1-13-11-15(20(24)25)7-9-17(13)19-10-8-16(28-19)12-18-21(26)29-23(30-22(18)27)14-5-3-2-4-6-14/h2-12,23H,1H3,(H,24,25)/p-1/b18-12-.
What are the key properties of 4-[5-[(4,6-dioxo-2-phenyl-1,3-dioxan-5-ylidene)methyl]furan-2-yl]-3-methylbenzoate?
4-[5-[(4,6-dioxo-2-phenyl-1,3-dioxan-5-ylidene)methyl]furan-2-yl]-3-methylbenzoate has a molecular weight of 403.37 g/mol, XLogP of 2.80, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-[(4,6-dioxo-2-phenyl-1,3-dioxan-5-ylidene)methyl]furan-2-yl]-3-methylbenzoate is sourced from PubChem (CID 6959123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).