C21H18Cl2N2S — CID 6959491
(4S)-4-(4-chlorophenyl)-8-[(4-chlorophenyl)methylidene]-1,3,4,5,6,7-hexahydroquinazoline-2-thione (PubChem CID 6959491) has the molecular formula C21H18Cl2N2S and a molecular weight of 401.36 g/mol. Its IUPAC name is (4S)-4-(4-chlorophenyl)-8-[(4-chlorophenyl)methylidene]-1,3,4,5,6,7-hexahydroquinazoline-2-thione.
| Compound Name | (4S)-4-(4-chlorophenyl)-8-[(4-chlorophenyl)methylidene]-1,3,4,5,6,7-hexahydroquinazoline-2-thione |
|---|---|
| PubChem CID | 6959491 |
| Molecular Formula | C21H18Cl2N2S |
| Molecular Weight | 401.36 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | (4S)-4-(4-chlorophenyl)-8-[(4-chlorophenyl)methylidene]-1,3,4,5,6,7-hexahydroquinazoline-2-thione |
| SMILES | S=C1NC2=C(CCCC2=Cc2ccc(Cl)cc2)[C@H](c2ccc(Cl)cc2)N1 |
| InChI | InChI=1S/C21H18Cl2N2S/c22-16-8-4-13(5-9-16)12-15-2-1-3-18-19(24-21(26)25-20(15)18)14-6-10-17(23)11-7-14/h4-12,19H,1-3H2,(H2,24,25,26)/t19-/m0/s1 |
| InChIKey | KVSPYRASURNEPV-IBGZPJMESA-N |
| XLogP | 6.03 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.36 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|