About 1-[(5S)-3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl]-4-ethylpiperazine-1,4-diium
1-[(5S)-3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl]-4-ethylpiperazine-1,4-diium (PubChem CID 6959533) has the molecular formula C20H25ClN2S+2
and a molecular weight of 360.95 g/mol. Its IUPAC name is 1-[(5S)-3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl]-4-ethylpiperazine-1,4-diium.
Molecular Properties
| Compound Name | 1-[(5S)-3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl]-4-ethylpiperazine-1,4-diium |
| PubChem CID | 6959533 |
| Molecular Formula | C20H25ClN2S+2 |
| Molecular Weight | 360.95 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 1-[(5S)-3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl]-4-ethylpiperazine-1,4-diium |
| SMILES | CC[NH+]1CC[NH+]([C@H]2Cc3ccccc3Sc3ccc(Cl)cc32)CC1 |
| InChI | InChI=1S/C20H23ClN2S/c1-2-22-9-11-23(12-10-22)18-13-15-5-3-4-6-19(15)24-20-8-7-16(21)14-17(18)20/h3-8,14,18H,2,9-13H2,1H3/p+2/t18-/m0/s1 |
| InChIKey | XHQHCGIOFLGRDM-SFHVURJKSA-P |
| XLogP | 1.89 |
| TPSA | 8.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.95 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[(5S)-3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl]-4-ethylpiperazine-1,4-diium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5S)-3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl]-4-ethylpiperazine-1,4-diium?
The IUPAC name of 1-[(5S)-3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl]-4-ethylpiperazine-1,4-diium (CID 6959533) is 1-[(5S)-3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl]-4-ethylpiperazine-1,4-diium.
What is the SMILES notation for 1-[(5S)-3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl]-4-ethylpiperazine-1,4-diium?
The canonical SMILES for 1-[(5S)-3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl]-4-ethylpiperazine-1,4-diium is CC[NH+]1CC[NH+]([C@H]2Cc3ccccc3Sc3ccc(Cl)cc32)CC1.
What is the InChIKey of 1-[(5S)-3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl]-4-ethylpiperazine-1,4-diium?
The InChIKey is XHQHCGIOFLGRDM-SFHVURJKSA-P. The full InChI is InChI=1S/C20H23ClN2S/c1-2-22-9-11-23(12-10-22)18-13-15-5-3-4-6-19(15)24-20-8-7-16(21)14-17(18)20/h3-8,14,18H,2,9-13H2,1H3/p+2/t18-/m0/s1.
What are the key properties of 1-[(5S)-3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl]-4-ethylpiperazine-1,4-diium?
1-[(5S)-3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl]-4-ethylpiperazine-1,4-diium has a molecular weight of 360.95 g/mol, XLogP of 1.89, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5S)-3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl]-4-ethylpiperazine-1,4-diium is sourced from PubChem (CID 6959533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).