C23H18Cl2N2O — CID 6962145
(4S,4aS,7S)-4-(2,3-dichlorophenyl)-2-methyl-5-oxo-7-phenyl-4a,6,7,8-tetrahydro-4H-quinoline-3-carbonitrile (PubChem CID 6962145) has the molecular formula C23H18Cl2N2O and a molecular weight of 409.32 g/mol. Its IUPAC name is (4S,4aS,7S)-4-(2,3-dichlorophenyl)-2-methyl-5-oxo-7-phenyl-4a,6,7,8-tetrahydro-4H-quinoline-3-carbonitrile.
| Compound Name | (4S,4aS,7S)-4-(2,3-dichlorophenyl)-2-methyl-5-oxo-7-phenyl-4a,6,7,8-tetrahydro-4H-quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 6962145 |
| Molecular Formula | C23H18Cl2N2O |
| Molecular Weight | 409.32 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | (4S,4aS,7S)-4-(2,3-dichlorophenyl)-2-methyl-5-oxo-7-phenyl-4a,6,7,8-tetrahydro-4H-quinoline-3-carbonitrile |
| SMILES | CC1=C(C#N)[C@@H](c2cccc(Cl)c2Cl)[C@@H]2C(=O)C[C@@H](c3ccccc3)CC2=N1 |
| InChI | InChI=1S/C23H18Cl2N2O/c1-13-17(12-26)21(16-8-5-9-18(24)23(16)25)22-19(27-13)10-15(11-20(22)28)14-6-3-2-4-7-14/h2-9,15,21-22H,10-11H2,1H3/t15-,21+,22-/m0/s1 |
| InChIKey | XTWNEAKQJKTHLJ-ARBPTSGCSA-N |
| XLogP | 6.09 |
| TPSA | 53.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.32 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |