About 4-(4-bromophenyl)-1-[(1S,3S)-3-methylcyclohexyl]piperidin-1-ium-4-ol
4-(4-bromophenyl)-1-[(1S,3S)-3-methylcyclohexyl]piperidin-1-ium-4-ol (PubChem CID 6962748) has the molecular formula C18H27BrNO+
and a molecular weight of 353.32 g/mol. Its IUPAC name is 4-(4-bromophenyl)-1-[(1S,3S)-3-methylcyclohexyl]piperidin-1-ium-4-ol.
Molecular Properties
| Compound Name | 4-(4-bromophenyl)-1-[(1S,3S)-3-methylcyclohexyl]piperidin-1-ium-4-ol |
| PubChem CID | 6962748 |
| Molecular Formula | C18H27BrNO+ |
| Molecular Weight | 353.32 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 4-(4-bromophenyl)-1-[(1S,3S)-3-methylcyclohexyl]piperidin-1-ium-4-ol |
| SMILES | C[C@H]1CCC[C@H]([NH+]2CCC(O)(c3ccc(Br)cc3)CC2)C1 |
| InChI | InChI=1S/C18H26BrNO/c1-14-3-2-4-17(13-14)20-11-9-18(21,10-12-20)15-5-7-16(19)8-6-15/h5-8,14,17,21H,2-4,9-13H2,1H3/p+1/t14-,17-/m0/s1 |
| InChIKey | LXLXQWAPLMGBSB-YOEHRIQHSA-O |
| XLogP | 2.89 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(4-bromophenyl)-1-[(1S,3S)-3-methylcyclohexyl]piperidin-1-ium-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-bromophenyl)-1-[(1S,3S)-3-methylcyclohexyl]piperidin-1-ium-4-ol?
The IUPAC name of 4-(4-bromophenyl)-1-[(1S,3S)-3-methylcyclohexyl]piperidin-1-ium-4-ol (CID 6962748) is 4-(4-bromophenyl)-1-[(1S,3S)-3-methylcyclohexyl]piperidin-1-ium-4-ol.
What is the SMILES notation for 4-(4-bromophenyl)-1-[(1S,3S)-3-methylcyclohexyl]piperidin-1-ium-4-ol?
The canonical SMILES for 4-(4-bromophenyl)-1-[(1S,3S)-3-methylcyclohexyl]piperidin-1-ium-4-ol is C[C@H]1CCC[C@H]([NH+]2CCC(O)(c3ccc(Br)cc3)CC2)C1.
What is the InChIKey of 4-(4-bromophenyl)-1-[(1S,3S)-3-methylcyclohexyl]piperidin-1-ium-4-ol?
The InChIKey is LXLXQWAPLMGBSB-YOEHRIQHSA-O. The full InChI is InChI=1S/C18H26BrNO/c1-14-3-2-4-17(13-14)20-11-9-18(21,10-12-20)15-5-7-16(19)8-6-15/h5-8,14,17,21H,2-4,9-13H2,1H3/p+1/t14-,17-/m0/s1.
What are the key properties of 4-(4-bromophenyl)-1-[(1S,3S)-3-methylcyclohexyl]piperidin-1-ium-4-ol?
4-(4-bromophenyl)-1-[(1S,3S)-3-methylcyclohexyl]piperidin-1-ium-4-ol has a molecular weight of 353.32 g/mol, XLogP of 2.89, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-bromophenyl)-1-[(1S,3S)-3-methylcyclohexyl]piperidin-1-ium-4-ol is sourced from PubChem (CID 6962748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).