C11H14N2O2S — CID 696316
N-(2,5-dimethoxyphenyl)-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 696316) has the molecular formula C11H14N2O2S and a molecular weight of 238.31 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | N-(2,5-dimethoxyphenyl)-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 696316 |
| Molecular Formula | C11H14N2O2S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | COc1ccc(OC)c(NC2=NCCS2)c1 |
| InChI | InChI=1S/C11H14N2O2S/c1-14-8-3-4-10(15-2)9(7-8)13-11-12-5-6-16-11/h3-4,7H,5-6H2,1-2H3,(H,12,13) |
| InChIKey | QPWQUTVAEWYAGY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |