C23H24N5O3+ — CID 6963679
6-amino-7-(furan-2-ylmethyl)-11-methyl-5-(piperidine-1-carbonyl)-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaen-2-one (PubChem CID 6963679) has the molecular formula C23H24N5O3+ and a molecular weight of 418.48 g/mol. Its IUPAC name is 6-amino-7-(furan-2-ylmethyl)-11-methyl-5-(piperidine-1-carbonyl)-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaen-2-one.
| Compound Name | 6-amino-7-(furan-2-ylmethyl)-11-methyl-5-(piperidine-1-carbonyl)-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaen-2-one |
|---|---|
| PubChem CID | 6963679 |
| Molecular Formula | C23H24N5O3+ |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 6-amino-7-(furan-2-ylmethyl)-11-methyl-5-(piperidine-1-carbonyl)-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaen-2-one |
| SMILES | Cc1cccn2c(=O)c3cc(C(=O)N4CCCCC4)c(N)[n+](Cc4ccco4)c3nc12 |
| InChI | InChI=1S/C23H23N5O3/c1-15-7-5-11-27-20(15)25-21-18(23(27)30)13-17(22(29)26-9-3-2-4-10-26)19(24)28(21)14-16-8-6-12-31-16/h5-8,11-13,24H,2-4,9-10,14H2,1H3/p+1 |
| InChIKey | AIIWPZONBQWKQX-UHFFFAOYSA-O |
| XLogP | 2.29 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|