About 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetate
2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetate (PubChem CID 6964079) has the molecular formula C6H7N2O3S-
and a molecular weight of 187.20 g/mol. Its IUPAC name is 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetate.
Molecular Properties
| Compound Name | 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetate |
| PubChem CID | 6964079 |
| Molecular Formula | C6H7N2O3S- |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.02 |
| IUPAC Name | 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetate |
| SMILES | CCc1nnc(SCC(=O)[O-])o1 |
| InChI | InChI=1S/C6H8N2O3S/c1-2-4-7-8-6(11-4)12-3-5(9)10/h2-3H2,1H3,(H,9,10)/p-1 |
| InChIKey | GJCMPTMRMSGIAX-UHFFFAOYSA-M |
| XLogP | -0.53 |
| TPSA | 79.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetate?
The IUPAC name of 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetate (CID 6964079) is 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetate.
What is the SMILES notation for 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetate?
The canonical SMILES for 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetate is CCc1nnc(SCC(=O)[O-])o1.
What is the InChIKey of 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetate?
The InChIKey is GJCMPTMRMSGIAX-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H8N2O3S/c1-2-4-7-8-6(11-4)12-3-5(9)10/h2-3H2,1H3,(H,9,10)/p-1.
What are the key properties of 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetate?
2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetate has a molecular weight of 187.20 g/mol, XLogP of -0.53, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetate is sourced from PubChem (CID 6964079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).