C25H32N2O3 — CID 6964714
ethyl (4S)-2,7,7-trimethyl-4-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-5-oxo-3,4,6,8-tetrahydroquinoline-3-carboxylate (PubChem CID 6964714) has the molecular formula C25H32N2O3 and a molecular weight of 408.54 g/mol. Its IUPAC name is ethyl (4S)-2,7,7-trimethyl-4-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-5-oxo-3,4,6,8-tetrahydroquinoline-3-carboxylate.
| Compound Name | ethyl (4S)-2,7,7-trimethyl-4-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-5-oxo-3,4,6,8-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 6964714 |
| Molecular Formula | C25H32N2O3 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | ethyl (4S)-2,7,7-trimethyl-4-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-5-oxo-3,4,6,8-tetrahydroquinoline-3-carboxylate |
| SMILES | CCOC(=O)C1C(C)=NC2=C(C(=O)CC(C)(C)C2)[C@@H]1c1ccc2c(c1)CCCN2C |
| InChI | InChI=1S/C25H32N2O3/c1-6-30-24(29)21-15(2)26-18-13-25(3,4)14-20(28)23(18)22(21)17-9-10-19-16(12-17)8-7-11-27(19)5/h9-10,12,21-22H,6-8,11,13-14H2,1-5H3/t21?,22-/m1/s1 |
| InChIKey | BGNIKVMFAFSPIL-FOIFJWKZSA-N |
| XLogP | 4.45 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |