C10H2O6 — CID 6966
furo[3,4-f][2]benzofuran-1,3,5,7-tetrone (PubChem CID 6966) has the molecular formula C10H2O6 and a molecular weight of 218.12 g/mol. Its IUPAC name is furo[3,4-f][2]benzofuran-1,3,5,7-tetrone.
| Compound Name | furo[3,4-f][2]benzofuran-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 6966 |
| Molecular Formula | C10H2O6 |
| Molecular Weight | 218.12 g/mol |
| Exact Mass | 217.99 |
| IUPAC Name | furo[3,4-f][2]benzofuran-1,3,5,7-tetrone |
| SMILES | O=c1oc(=O)c2cc3c(=O)oc(=O)c3cc12 |
| InChI | InChI=1S/C10H2O6/c11-7-3-1-4-6(10(14)16-8(4)12)2-5(3)9(13)15-7/h1-2H |
| InChIKey | ANSXAPJVJOKRDJ-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 94.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.12 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |