About (5S)-3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate
(5S)-3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate (PubChem CID 6966211) has the molecular formula C11H10NO4-
and a molecular weight of 220.20 g/mol. Its IUPAC name is (5S)-3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate.
Molecular Properties
| Compound Name | (5S)-3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate |
| PubChem CID | 6966211 |
| Molecular Formula | C11H10NO4- |
| Molecular Weight | 220.20 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | (5S)-3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate |
| SMILES | COc1ccccc1C1=NO[C@H](C(=O)[O-])C1 |
| InChI | InChI=1S/C11H11NO4/c1-15-9-5-3-2-4-7(9)8-6-10(11(13)14)16-12-8/h2-5,10H,6H2,1H3,(H,13,14)/p-1/t10-/m0/s1 |
| InChIKey | DZQPCQZVKAAAJK-JTQLQIEISA-M |
| XLogP | -0.06 |
| TPSA | 70.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.20 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5S)-3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate?
The IUPAC name of (5S)-3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate (CID 6966211) is (5S)-3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate.
What is the SMILES notation for (5S)-3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate?
The canonical SMILES for (5S)-3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate is COc1ccccc1C1=NO[C@H](C(=O)[O-])C1.
What is the InChIKey of (5S)-3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate?
The InChIKey is DZQPCQZVKAAAJK-JTQLQIEISA-M. The full InChI is InChI=1S/C11H11NO4/c1-15-9-5-3-2-4-7(9)8-6-10(11(13)14)16-12-8/h2-5,10H,6H2,1H3,(H,13,14)/p-1/t10-/m0/s1.
What are the key properties of (5S)-3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate?
(5S)-3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate has a molecular weight of 220.20 g/mol, XLogP of -0.06, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate is sourced from PubChem (CID 6966211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).