C25H27FNO+ — CID 6967268
(2S,3S,4R,6S)-4-(4-fluorophenyl)-1,3-dimethyl-2,6-diphenylpiperidin-1-ium-4-ol (PubChem CID 6967268) has the molecular formula C25H27FNO+ and a molecular weight of 376.50 g/mol. Its IUPAC name is (2S,3S,4R,6S)-4-(4-fluorophenyl)-1,3-dimethyl-2,6-diphenylpiperidin-1-ium-4-ol.
| Compound Name | (2S,3S,4R,6S)-4-(4-fluorophenyl)-1,3-dimethyl-2,6-diphenylpiperidin-1-ium-4-ol |
|---|---|
| PubChem CID | 6967268 |
| Molecular Formula | C25H27FNO+ |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | (2S,3S,4R,6S)-4-(4-fluorophenyl)-1,3-dimethyl-2,6-diphenylpiperidin-1-ium-4-ol |
| SMILES | C[C@H]1[C@@H](c2ccccc2)[NH+](C)[C@H](c2ccccc2)C[C@]1(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H26FNO/c1-18-24(20-11-7-4-8-12-20)27(2)23(19-9-5-3-6-10-19)17-25(18,28)21-13-15-22(26)16-14-21/h3-16,18,23-24,28H,17H2,1-2H3/p+1/t18-,23-,24-,25+/m0/s1 |
| InChIKey | NTQGEZJOMVFLMK-PAWHMVCQSA-O |
| XLogP | 4.05 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |