C21H24N5O3+ — CID 6967592
N-(2-morpholin-4-ium-4-ylethyl)-4,6-diphenoxy-1,3,5-triazin-2-amine (PubChem CID 6967592) has the molecular formula C21H24N5O3+ and a molecular weight of 394.45 g/mol. Its IUPAC name is N-(2-morpholin-4-ium-4-ylethyl)-4,6-diphenoxy-1,3,5-triazin-2-amine.
| Compound Name | N-(2-morpholin-4-ium-4-ylethyl)-4,6-diphenoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 6967592 |
| Molecular Formula | C21H24N5O3+ |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | N-(2-morpholin-4-ium-4-ylethyl)-4,6-diphenoxy-1,3,5-triazin-2-amine |
| SMILES | c1ccc(Oc2nc(NCC[NH+]3CCOCC3)nc(Oc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C21H23N5O3/c1-3-7-17(8-4-1)28-20-23-19(22-11-12-26-13-15-27-16-14-26)24-21(25-20)29-18-9-5-2-6-10-18/h1-10H,11-16H2,(H,22,23,24,25)/p+1 |
| InChIKey | IFJRCESNPWRCLL-UHFFFAOYSA-O |
| XLogP | 1.78 |
| TPSA | 82.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |