C18H14N5O4- — CID 6968325
2-methyl-4-nitro-6-[(Z)-[(3-phenyl-1H-pyrazole-5-carbonyl)hydrazinylidene]methyl]phenolate (PubChem CID 6968325) has the molecular formula C18H14N5O4- and a molecular weight of 364.34 g/mol. Its IUPAC name is 2-methyl-4-nitro-6-[(Z)-[(3-phenyl-1H-pyrazole-5-carbonyl)hydrazinylidene]methyl]phenolate.
| Compound Name | 2-methyl-4-nitro-6-[(Z)-[(3-phenyl-1H-pyrazole-5-carbonyl)hydrazinylidene]methyl]phenolate |
|---|---|
| PubChem CID | 6968325 |
| Molecular Formula | C18H14N5O4- |
| Molecular Weight | 364.34 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 2-methyl-4-nitro-6-[(Z)-[(3-phenyl-1H-pyrazole-5-carbonyl)hydrazinylidene]methyl]phenolate |
| SMILES | Cc1cc([N+](=O)[O-])cc(/C=N\NC(=O)c2cc(-c3ccccc3)n[nH]2)c1[O-] |
| InChI | InChI=1S/C18H15N5O4/c1-11-7-14(23(26)27)8-13(17(11)24)10-19-22-18(25)16-9-15(20-21-16)12-5-3-2-4-6-12/h2-10,24H,1H3,(H,20,21)(H,22,25)/p-1/b19-10- |
| InChIKey | KCOWEIPMLXETIT-GRSHGNNSSA-M |
| XLogP | 2.13 |
| TPSA | 136.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|