C14H18NO3- — CID 6968937
(2S)-2-[(4-ethylbenzoyl)amino]-3-methylbutanoate (PubChem CID 6968937) has the molecular formula C14H18NO3- and a molecular weight of 248.30 g/mol. Its IUPAC name is (2S)-2-[(4-ethylbenzoyl)amino]-3-methylbutanoate.
| Compound Name | (2S)-2-[(4-ethylbenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 6968937 |
| Molecular Formula | C14H18NO3- |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | (2S)-2-[(4-ethylbenzoyl)amino]-3-methylbutanoate |
| SMILES | CCc1ccc(C(=O)N[C@H](C(=O)[O-])C(C)C)cc1 |
| InChI | InChI=1S/C14H19NO3/c1-4-10-5-7-11(8-6-10)13(16)15-12(9(2)3)14(17)18/h5-9,12H,4H2,1-3H3,(H,15,16)(H,17,18)/p-1/t12-/m0/s1 |
| InChIKey | OPPMQFXQMJPMMZ-LBPRGKRZSA-M |
| XLogP | 0.75 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |