About 4-imidazo[1,2-a]pyridin-2-ylaniline
4-imidazo[1,2-a]pyridin-2-ylaniline (PubChem CID 696936) has the molecular formula C13H11N3
and a molecular weight of 209.25 g/mol. Its IUPAC name is 4-imidazo[1,2-a]pyridin-2-ylaniline.
Molecular Properties
| Compound Name | 4-imidazo[1,2-a]pyridin-2-ylaniline |
| PubChem CID | 696936 |
| Molecular Formula | C13H11N3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 4-imidazo[1,2-a]pyridin-2-ylaniline |
| SMILES | Nc1ccc(-c2cn3ccccc3n2)cc1 |
| InChI | InChI=1S/C13H11N3/c14-11-6-4-10(5-7-11)12-9-16-8-2-1-3-13(16)15-12/h1-9H,14H2 |
| InChIKey | FPCHINCJTRAFAK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-imidazo[1,2-a]pyridin-2-ylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-imidazo[1,2-a]pyridin-2-ylaniline?
The IUPAC name of 4-imidazo[1,2-a]pyridin-2-ylaniline (CID 696936) is 4-imidazo[1,2-a]pyridin-2-ylaniline.
What is the SMILES notation for 4-imidazo[1,2-a]pyridin-2-ylaniline?
The canonical SMILES for 4-imidazo[1,2-a]pyridin-2-ylaniline is Nc1ccc(-c2cn3ccccc3n2)cc1.
What is the InChIKey of 4-imidazo[1,2-a]pyridin-2-ylaniline?
The InChIKey is FPCHINCJTRAFAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3/c14-11-6-4-10(5-7-11)12-9-16-8-2-1-3-13(16)15-12/h1-9H,14H2.
What are the key properties of 4-imidazo[1,2-a]pyridin-2-ylaniline?
4-imidazo[1,2-a]pyridin-2-ylaniline has a molecular weight of 209.25 g/mol, XLogP of 2.58, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-imidazo[1,2-a]pyridin-2-ylaniline is sourced from PubChem (CID 696936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).