C30H26N2O5 — CID 6969430
benzyl (4R,7S)-2-methyl-4-(4-nitrophenyl)-5-oxo-7-phenyl-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate (PubChem CID 6969430) has the molecular formula C30H26N2O5 and a molecular weight of 494.55 g/mol. Its IUPAC name is benzyl (4R,7S)-2-methyl-4-(4-nitrophenyl)-5-oxo-7-phenyl-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate.
| Compound Name | benzyl (4R,7S)-2-methyl-4-(4-nitrophenyl)-5-oxo-7-phenyl-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 6969430 |
| Molecular Formula | C30H26N2O5 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | benzyl (4R,7S)-2-methyl-4-(4-nitrophenyl)-5-oxo-7-phenyl-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
| SMILES | CC1=NC2=C(C(=O)C[C@@H](c3ccccc3)C2)[C@@H](c2ccc([N+](=O)[O-])cc2)C1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C30H26N2O5/c1-19-27(30(34)37-18-20-8-4-2-5-9-20)28(22-12-14-24(15-13-22)32(35)36)29-25(31-19)16-23(17-26(29)33)21-10-6-3-7-11-21/h2-15,23,27-28H,16-18H2,1H3/t23-,27?,28-/m0/s1 |
| InChIKey | ADURSTOQPRTTKR-NWRKHDGFSA-N |
| XLogP | 5.91 |
| TPSA | 98.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|