C22H19ClNO7- — CID 6969628
3-[(2R)-3-[(4-chlorophenyl)-hydroxymethylidene]-2-(2,4-dimethoxyphenyl)-4,5-dioxopyrrolidin-1-yl]propanoate (PubChem CID 6969628) has the molecular formula C22H19ClNO7- and a molecular weight of 444.85 g/mol. Its IUPAC name is 3-[(2R)-3-[(4-chlorophenyl)-hydroxymethylidene]-2-(2,4-dimethoxyphenyl)-4,5-dioxopyrrolidin-1-yl]propanoate.
| Compound Name | 3-[(2R)-3-[(4-chlorophenyl)-hydroxymethylidene]-2-(2,4-dimethoxyphenyl)-4,5-dioxopyrrolidin-1-yl]propanoate |
|---|---|
| PubChem CID | 6969628 |
| Molecular Formula | C22H19ClNO7- |
| Molecular Weight | 444.85 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | 3-[(2R)-3-[(4-chlorophenyl)-hydroxymethylidene]-2-(2,4-dimethoxyphenyl)-4,5-dioxopyrrolidin-1-yl]propanoate |
| SMILES | COc1ccc([C@@H]2C(=C(O)c3ccc(Cl)cc3)C(=O)C(=O)N2CCC(=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C22H20ClNO7/c1-30-14-7-8-15(16(11-14)31-2)19-18(20(27)12-3-5-13(23)6-4-12)21(28)22(29)24(19)10-9-17(25)26/h3-8,11,19,27H,9-10H2,1-2H3,(H,25,26)/p-1/t19-/m1/s1 |
| InChIKey | AFGBLPIBNJGTLI-LJQANCHMSA-M |
| XLogP | 1.92 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.85 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|