About (E)-2-methylbut-2-enoate
(E)-2-methylbut-2-enoate (PubChem CID 6971144) has the molecular formula C5H7O2-
and a molecular weight of 99.11 g/mol. Its IUPAC name is (E)-2-methylbut-2-enoate.
Molecular Properties
| Compound Name | (E)-2-methylbut-2-enoate |
| PubChem CID | 6971144 |
| Molecular Formula | C5H7O2- |
| Molecular Weight | 99.11 g/mol |
| Exact Mass | 99.05 |
| IUPAC Name | (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)[O-] |
| InChI | InChI=1S/C5H8O2/c1-3-4(2)5(6)7/h3H,1-2H3,(H,6,7)/p-1/b4-3+ |
| InChIKey | UIERETOOQGIECD-ONEGZZNKSA-M |
| XLogP | -0.30 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.11 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-methylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-methylbut-2-enoate?
The IUPAC name of (E)-2-methylbut-2-enoate (CID 6971144) is (E)-2-methylbut-2-enoate.
What is the SMILES notation for (E)-2-methylbut-2-enoate?
The canonical SMILES for (E)-2-methylbut-2-enoate is C/C=C(\C)C(=O)[O-].
What is the InChIKey of (E)-2-methylbut-2-enoate?
The InChIKey is UIERETOOQGIECD-ONEGZZNKSA-M. The full InChI is InChI=1S/C5H8O2/c1-3-4(2)5(6)7/h3H,1-2H3,(H,6,7)/p-1/b4-3+.
What are the key properties of (E)-2-methylbut-2-enoate?
(E)-2-methylbut-2-enoate has a molecular weight of 99.11 g/mol, XLogP of -0.30, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-methylbut-2-enoate is sourced from PubChem (CID 6971144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).