About (3-oxo-1,2-oxazol-5-yl)methylazanium
(3-oxo-1,2-oxazol-5-yl)methylazanium (PubChem CID 6971146) has the molecular formula C4H7N2O2+
and a molecular weight of 115.11 g/mol. Its IUPAC name is (3-oxo-1,2-oxazol-5-yl)methylazanium.
Molecular Properties
| Compound Name | (3-oxo-1,2-oxazol-5-yl)methylazanium |
| PubChem CID | 6971146 |
| Molecular Formula | C4H7N2O2+ |
| Molecular Weight | 115.11 g/mol |
| Exact Mass | 115.05 |
| IUPAC Name | (3-oxo-1,2-oxazol-5-yl)methylazanium |
| SMILES | [NH3+]Cc1cc(=O)[nH]o1 |
| InChI | InChI=1S/C4H6N2O2/c5-2-3-1-4(7)6-8-3/h1H,2,5H2,(H,6,7)/p+1 |
| InChIKey | ZJQHPWUVQPJPQT-UHFFFAOYSA-O |
| XLogP | -1.29 |
| TPSA | 73.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.11 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3-oxo-1,2-oxazol-5-yl)methylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-oxo-1,2-oxazol-5-yl)methylazanium?
The IUPAC name of (3-oxo-1,2-oxazol-5-yl)methylazanium (CID 6971146) is (3-oxo-1,2-oxazol-5-yl)methylazanium.
What is the SMILES notation for (3-oxo-1,2-oxazol-5-yl)methylazanium?
The canonical SMILES for (3-oxo-1,2-oxazol-5-yl)methylazanium is [NH3+]Cc1cc(=O)[nH]o1.
What is the InChIKey of (3-oxo-1,2-oxazol-5-yl)methylazanium?
The InChIKey is ZJQHPWUVQPJPQT-UHFFFAOYSA-O. The full InChI is InChI=1S/C4H6N2O2/c5-2-3-1-4(7)6-8-3/h1H,2,5H2,(H,6,7)/p+1.
What are the key properties of (3-oxo-1,2-oxazol-5-yl)methylazanium?
(3-oxo-1,2-oxazol-5-yl)methylazanium has a molecular weight of 115.11 g/mol, XLogP of -1.29, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-oxo-1,2-oxazol-5-yl)methylazanium is sourced from PubChem (CID 6971146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).