C25H30N3O6S+ — CID 6971515
4-[hydroxy-[(2S)-1-(2-morpholin-4-ium-4-ylethyl)-4,5-dioxo-2-phenylpyrrolidin-3-ylidene]methyl]-N,N-dimethylbenzenesulfonamide (PubChem CID 6971515) has the molecular formula C25H30N3O6S+ and a molecular weight of 500.60 g/mol. Its IUPAC name is 4-[hydroxy-[(2S)-1-(2-morpholin-4-ium-4-ylethyl)-4,5-dioxo-2-phenylpyrrolidin-3-ylidene]methyl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-[hydroxy-[(2S)-1-(2-morpholin-4-ium-4-ylethyl)-4,5-dioxo-2-phenylpyrrolidin-3-ylidene]methyl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 6971515 |
| Molecular Formula | C25H30N3O6S+ |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | 4-[hydroxy-[(2S)-1-(2-morpholin-4-ium-4-ylethyl)-4,5-dioxo-2-phenylpyrrolidin-3-ylidene]methyl]-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(O)=C2C(=O)C(=O)N(CC[NH+]3CCOCC3)[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C25H29N3O6S/c1-26(2)35(32,33)20-10-8-19(9-11-20)23(29)21-22(18-6-4-3-5-7-18)28(25(31)24(21)30)13-12-27-14-16-34-17-15-27/h3-11,22,29H,12-17H2,1-2H3/p+1/t22-/m0/s1 |
| InChIKey | STALZKWFDROAPJ-QFIPXVFZSA-O |
| XLogP | 0.27 |
| TPSA | 108.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|