About 1-(benzenesulfonyl)-1,2,4-triazol-3-amine
1-(benzenesulfonyl)-1,2,4-triazol-3-amine (PubChem CID 697181) has the molecular formula C8H8N4O2S
and a molecular weight of 224.25 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 1-(benzenesulfonyl)-1,2,4-triazol-3-amine |
| PubChem CID | 697181 |
| Molecular Formula | C8H8N4O2S |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 1-(benzenesulfonyl)-1,2,4-triazol-3-amine |
| SMILES | Nc1ncn(S(=O)(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C8H8N4O2S/c9-8-10-6-12(11-8)15(13,14)7-4-2-1-3-5-7/h1-6H,(H2,9,11) |
| InChIKey | FWCIEWLJSUAFHO-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(benzenesulfonyl)-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(benzenesulfonyl)-1,2,4-triazol-3-amine?
The IUPAC name of 1-(benzenesulfonyl)-1,2,4-triazol-3-amine (CID 697181) is 1-(benzenesulfonyl)-1,2,4-triazol-3-amine.
What is the SMILES notation for 1-(benzenesulfonyl)-1,2,4-triazol-3-amine?
The canonical SMILES for 1-(benzenesulfonyl)-1,2,4-triazol-3-amine is Nc1ncn(S(=O)(=O)c2ccccc2)n1.
What is the InChIKey of 1-(benzenesulfonyl)-1,2,4-triazol-3-amine?
The InChIKey is FWCIEWLJSUAFHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4O2S/c9-8-10-6-12(11-8)15(13,14)7-4-2-1-3-5-7/h1-6H,(H2,9,11).
What are the key properties of 1-(benzenesulfonyl)-1,2,4-triazol-3-amine?
1-(benzenesulfonyl)-1,2,4-triazol-3-amine has a molecular weight of 224.25 g/mol, XLogP of 0.10, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(benzenesulfonyl)-1,2,4-triazol-3-amine is sourced from PubChem (CID 697181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).