About 2-N-benzyl-4-N-(2,4-dimethylphenyl)-6-methylpyrimidine-2,4-diamine
2-N-benzyl-4-N-(2,4-dimethylphenyl)-6-methylpyrimidine-2,4-diamine (PubChem CID 697227) has the molecular formula C20H22N4
and a molecular weight of 318.42 g/mol. Its IUPAC name is 2-N-benzyl-4-N-(2,4-dimethylphenyl)-6-methylpyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 2-N-benzyl-4-N-(2,4-dimethylphenyl)-6-methylpyrimidine-2,4-diamine |
| PubChem CID | 697227 |
| Molecular Formula | C20H22N4 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 2-N-benzyl-4-N-(2,4-dimethylphenyl)-6-methylpyrimidine-2,4-diamine |
| SMILES | Cc1ccc(Nc2cc(C)nc(NCc3ccccc3)n2)c(C)c1 |
| InChI | InChI=1S/C20H22N4/c1-14-9-10-18(15(2)11-14)23-19-12-16(3)22-20(24-19)21-13-17-7-5-4-6-8-17/h4-12H,13H2,1-3H3,(H2,21,22,23,24) |
| InChIKey | VIRZRROCTSPOES-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-N-benzyl-4-N-(2,4-dimethylphenyl)-6-methylpyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-benzyl-4-N-(2,4-dimethylphenyl)-6-methylpyrimidine-2,4-diamine?
The IUPAC name of 2-N-benzyl-4-N-(2,4-dimethylphenyl)-6-methylpyrimidine-2,4-diamine (CID 697227) is 2-N-benzyl-4-N-(2,4-dimethylphenyl)-6-methylpyrimidine-2,4-diamine.
What is the SMILES notation for 2-N-benzyl-4-N-(2,4-dimethylphenyl)-6-methylpyrimidine-2,4-diamine?
The canonical SMILES for 2-N-benzyl-4-N-(2,4-dimethylphenyl)-6-methylpyrimidine-2,4-diamine is Cc1ccc(Nc2cc(C)nc(NCc3ccccc3)n2)c(C)c1.
What is the InChIKey of 2-N-benzyl-4-N-(2,4-dimethylphenyl)-6-methylpyrimidine-2,4-diamine?
The InChIKey is VIRZRROCTSPOES-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N4/c1-14-9-10-18(15(2)11-14)23-19-12-16(3)22-20(24-19)21-13-17-7-5-4-6-8-17/h4-12H,13H2,1-3H3,(H2,21,22,23,24).
What are the key properties of 2-N-benzyl-4-N-(2,4-dimethylphenyl)-6-methylpyrimidine-2,4-diamine?
2-N-benzyl-4-N-(2,4-dimethylphenyl)-6-methylpyrimidine-2,4-diamine has a molecular weight of 318.42 g/mol, XLogP of 4.76, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-benzyl-4-N-(2,4-dimethylphenyl)-6-methylpyrimidine-2,4-diamine is sourced from PubChem (CID 697227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).