C18H17ClN4 — CID 697231
2-N-benzyl-4-N-(4-chlorophenyl)-6-methylpyrimidine-2,4-diamine (PubChem CID 697231) has the molecular formula C18H17ClN4 and a molecular weight of 324.82 g/mol. Its IUPAC name is 2-N-benzyl-4-N-(4-chlorophenyl)-6-methylpyrimidine-2,4-diamine.
| Compound Name | 2-N-benzyl-4-N-(4-chlorophenyl)-6-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 697231 |
| Molecular Formula | C18H17ClN4 |
| Molecular Weight | 324.82 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 2-N-benzyl-4-N-(4-chlorophenyl)-6-methylpyrimidine-2,4-diamine |
| SMILES | Cc1cc(Nc2ccc(Cl)cc2)nc(NCc2ccccc2)n1 |
| InChI | InChI=1S/C18H17ClN4/c1-13-11-17(22-16-9-7-15(19)8-10-16)23-18(21-13)20-12-14-5-3-2-4-6-14/h2-11H,12H2,1H3,(H2,20,21,22,23) |
| InChIKey | LUXQVTQTDWHZFI-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.82 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |