C15H9ClNO5S2- — CID 6972766
2-[(1R,10R)-4-chloro-9,15-dioxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,13(17)-tetraen-10-yl]acetate (PubChem CID 6972766) has the molecular formula C15H9ClNO5S2- and a molecular weight of 382.83 g/mol. Its IUPAC name is 2-[(1R,10R)-4-chloro-9,15-dioxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,13(17)-tetraen-10-yl]acetate.
| Compound Name | 2-[(1R,10R)-4-chloro-9,15-dioxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,13(17)-tetraen-10-yl]acetate |
|---|---|
| PubChem CID | 6972766 |
| Molecular Formula | C15H9ClNO5S2- |
| Molecular Weight | 382.83 g/mol |
| Exact Mass | 381.96 |
| IUPAC Name | 2-[(1R,10R)-4-chloro-9,15-dioxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,13(17)-tetraen-10-yl]acetate |
| SMILES | O=C([O-])C[C@@]12CSc3[nH]c(=O)sc3[C@@H]1c1cc(Cl)ccc1OC2=O |
| InChI | InChI=1S/C15H10ClNO5S2/c16-6-1-2-8-7(3-6)10-11-12(17-14(21)24-11)23-5-15(10,4-9(18)19)13(20)22-8/h1-3,10H,4-5H2,(H,17,21)(H,18,19)/p-1/t10-,15+/m0/s1 |
| InChIKey | CMSUIVMSFVOWNX-ZUZCIYMTSA-M |
| XLogP | 1.37 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.83 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|