About 4-N-(4-phenyl-1,3-thiazol-2-yl)benzene-1,4-diamine
4-N-(4-phenyl-1,3-thiazol-2-yl)benzene-1,4-diamine (PubChem CID 697284) has the molecular formula C15H13N3S
and a molecular weight of 267.36 g/mol. Its IUPAC name is 4-N-(4-phenyl-1,3-thiazol-2-yl)benzene-1,4-diamine.
Molecular Properties
| Compound Name | 4-N-(4-phenyl-1,3-thiazol-2-yl)benzene-1,4-diamine |
| PubChem CID | 697284 |
| Molecular Formula | C15H13N3S |
| Molecular Weight | 267.36 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 4-N-(4-phenyl-1,3-thiazol-2-yl)benzene-1,4-diamine |
| SMILES | Nc1ccc(Nc2nc(-c3ccccc3)cs2)cc1 |
| InChI | InChI=1S/C15H13N3S/c16-12-6-8-13(9-7-12)17-15-18-14(10-19-15)11-4-2-1-3-5-11/h1-10H,16H2,(H,17,18) |
| InChIKey | UCTKBXRPOAHLQM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.36 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-N-(4-phenyl-1,3-thiazol-2-yl)benzene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-(4-phenyl-1,3-thiazol-2-yl)benzene-1,4-diamine?
The IUPAC name of 4-N-(4-phenyl-1,3-thiazol-2-yl)benzene-1,4-diamine (CID 697284) is 4-N-(4-phenyl-1,3-thiazol-2-yl)benzene-1,4-diamine.
What is the SMILES notation for 4-N-(4-phenyl-1,3-thiazol-2-yl)benzene-1,4-diamine?
The canonical SMILES for 4-N-(4-phenyl-1,3-thiazol-2-yl)benzene-1,4-diamine is Nc1ccc(Nc2nc(-c3ccccc3)cs2)cc1.
What is the InChIKey of 4-N-(4-phenyl-1,3-thiazol-2-yl)benzene-1,4-diamine?
The InChIKey is UCTKBXRPOAHLQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3S/c16-12-6-8-13(9-7-12)17-15-18-14(10-19-15)11-4-2-1-3-5-11/h1-10H,16H2,(H,17,18).
What are the key properties of 4-N-(4-phenyl-1,3-thiazol-2-yl)benzene-1,4-diamine?
4-N-(4-phenyl-1,3-thiazol-2-yl)benzene-1,4-diamine has a molecular weight of 267.36 g/mol, XLogP of 4.14, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-(4-phenyl-1,3-thiazol-2-yl)benzene-1,4-diamine is sourced from PubChem (CID 697284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).