About (2S)-2-[(4,4-dimethyl-2,6-dioxocyclohexyl)methylideneamino]butanedioate
(2S)-2-[(4,4-dimethyl-2,6-dioxocyclohexyl)methylideneamino]butanedioate (PubChem CID 6973613) has the molecular formula C13H15NO6-2
and a molecular weight of 281.26 g/mol. Its IUPAC name is (2S)-2-[(4,4-dimethyl-2,6-dioxocyclohexyl)methylideneamino]butanedioate.
Molecular Properties
| Compound Name | (2S)-2-[(4,4-dimethyl-2,6-dioxocyclohexyl)methylideneamino]butanedioate |
| PubChem CID | 6973613 |
| Molecular Formula | C13H15NO6-2 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | (2S)-2-[(4,4-dimethyl-2,6-dioxocyclohexyl)methylideneamino]butanedioate |
| SMILES | CC1(C)CC(=O)C(/C=N/[C@@H](CC(=O)[O-])C(=O)[O-])C(=O)C1 |
| InChI | InChI=1S/C13H17NO6/c1-13(2)4-9(15)7(10(16)5-13)6-14-8(12(19)20)3-11(17)18/h6-8H,3-5H2,1-2H3,(H,17,18)(H,19,20)/p-2/b14-6+/t8-/m0/s1 |
| InChIKey | DIUWVWUQHHYUCP-RQTLQMQPSA-L |
| XLogP | -2.11 |
| TPSA | 126.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-[(4,4-dimethyl-2,6-dioxocyclohexyl)methylideneamino]butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(4,4-dimethyl-2,6-dioxocyclohexyl)methylideneamino]butanedioate?
The IUPAC name of (2S)-2-[(4,4-dimethyl-2,6-dioxocyclohexyl)methylideneamino]butanedioate (CID 6973613) is (2S)-2-[(4,4-dimethyl-2,6-dioxocyclohexyl)methylideneamino]butanedioate.
What is the SMILES notation for (2S)-2-[(4,4-dimethyl-2,6-dioxocyclohexyl)methylideneamino]butanedioate?
The canonical SMILES for (2S)-2-[(4,4-dimethyl-2,6-dioxocyclohexyl)methylideneamino]butanedioate is CC1(C)CC(=O)C(/C=N/[C@@H](CC(=O)[O-])C(=O)[O-])C(=O)C1.
What is the InChIKey of (2S)-2-[(4,4-dimethyl-2,6-dioxocyclohexyl)methylideneamino]butanedioate?
The InChIKey is DIUWVWUQHHYUCP-RQTLQMQPSA-L. The full InChI is InChI=1S/C13H17NO6/c1-13(2)4-9(15)7(10(16)5-13)6-14-8(12(19)20)3-11(17)18/h6-8H,3-5H2,1-2H3,(H,17,18)(H,19,20)/p-2/b14-6+/t8-/m0/s1.
What are the key properties of (2S)-2-[(4,4-dimethyl-2,6-dioxocyclohexyl)methylideneamino]butanedioate?
(2S)-2-[(4,4-dimethyl-2,6-dioxocyclohexyl)methylideneamino]butanedioate has a molecular weight of 281.26 g/mol, XLogP of -2.11, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(4,4-dimethyl-2,6-dioxocyclohexyl)methylideneamino]butanedioate is sourced from PubChem (CID 6973613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).