About (2S,6S)-4-hydroxypiperidin-1-ium-2,6-dicarboxamide
(2S,6S)-4-hydroxypiperidin-1-ium-2,6-dicarboxamide (PubChem CID 6974238) has the molecular formula C7H14N3O3+
and a molecular weight of 188.21 g/mol. Its IUPAC name is (2S,6S)-4-hydroxypiperidin-1-ium-2,6-dicarboxamide.
Molecular Properties
| Compound Name | (2S,6S)-4-hydroxypiperidin-1-ium-2,6-dicarboxamide |
| PubChem CID | 6974238 |
| Molecular Formula | C7H14N3O3+ |
| Molecular Weight | 188.21 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | (2S,6S)-4-hydroxypiperidin-1-ium-2,6-dicarboxamide |
| SMILES | NC(=O)[C@@H]1CC(O)C[C@@H](C(N)=O)[NH2+]1 |
| InChI | InChI=1S/C7H13N3O3/c8-6(12)4-1-3(11)2-5(10-4)7(9)13/h3-5,10-11H,1-2H2,(H2,8,12)(H2,9,13)/p+1/t4-,5-/m0/s1 |
| InChIKey | UDSQEOXEJJEOMY-WHFBIAKZSA-O |
| XLogP | -3.59 |
| TPSA | 123.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.21 |
| LogP ≤ 5 | -3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S,6S)-4-hydroxypiperidin-1-ium-2,6-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,6S)-4-hydroxypiperidin-1-ium-2,6-dicarboxamide?
The IUPAC name of (2S,6S)-4-hydroxypiperidin-1-ium-2,6-dicarboxamide (CID 6974238) is (2S,6S)-4-hydroxypiperidin-1-ium-2,6-dicarboxamide.
What is the SMILES notation for (2S,6S)-4-hydroxypiperidin-1-ium-2,6-dicarboxamide?
The canonical SMILES for (2S,6S)-4-hydroxypiperidin-1-ium-2,6-dicarboxamide is NC(=O)[C@@H]1CC(O)C[C@@H](C(N)=O)[NH2+]1.
What is the InChIKey of (2S,6S)-4-hydroxypiperidin-1-ium-2,6-dicarboxamide?
The InChIKey is UDSQEOXEJJEOMY-WHFBIAKZSA-O. The full InChI is InChI=1S/C7H13N3O3/c8-6(12)4-1-3(11)2-5(10-4)7(9)13/h3-5,10-11H,1-2H2,(H2,8,12)(H2,9,13)/p+1/t4-,5-/m0/s1.
What are the key properties of (2S,6S)-4-hydroxypiperidin-1-ium-2,6-dicarboxamide?
(2S,6S)-4-hydroxypiperidin-1-ium-2,6-dicarboxamide has a molecular weight of 188.21 g/mol, XLogP of -3.59, 2 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,6S)-4-hydroxypiperidin-1-ium-2,6-dicarboxamide is sourced from PubChem (CID 6974238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).