C17H17N3OS — CID 697443
7,7-dimethyl-2-(4-methylphenyl)-6,8-dihydro-[1,2,4]triazolo[5,1-b][1,3]benzothiazol-5-one (PubChem CID 697443) has the molecular formula C17H17N3OS and a molecular weight of 311.41 g/mol. Its IUPAC name is 7,7-dimethyl-2-(4-methylphenyl)-6,8-dihydro-[1,2,4]triazolo[5,1-b][1,3]benzothiazol-5-one.
| Compound Name | 7,7-dimethyl-2-(4-methylphenyl)-6,8-dihydro-[1,2,4]triazolo[5,1-b][1,3]benzothiazol-5-one |
|---|---|
| PubChem CID | 697443 |
| Molecular Formula | C17H17N3OS |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 7,7-dimethyl-2-(4-methylphenyl)-6,8-dihydro-[1,2,4]triazolo[5,1-b][1,3]benzothiazol-5-one |
| SMILES | Cc1ccc(-c2nc3sc4c(n3n2)CC(C)(C)CC4=O)cc1 |
| InChI | InChI=1S/C17H17N3OS/c1-10-4-6-11(7-5-10)15-18-16-20(19-15)12-8-17(2,3)9-13(21)14(12)22-16/h4-7H,8-9H2,1-3H3 |
| InChIKey | CZZZJDLIZHARTG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |