C20H23F3N2O — CID 6975605
(2S)-3-(4-benzhydrylpiperazin-1-yl)-1,1,1-trifluoropropan-2-ol (PubChem CID 6975605) has the molecular formula C20H23F3N2O and a molecular weight of 364.41 g/mol. Its IUPAC name is (2S)-3-(4-benzhydrylpiperazin-1-yl)-1,1,1-trifluoropropan-2-ol.
| Compound Name | (2S)-3-(4-benzhydrylpiperazin-1-yl)-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 6975605 |
| Molecular Formula | C20H23F3N2O |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | (2S)-3-(4-benzhydrylpiperazin-1-yl)-1,1,1-trifluoropropan-2-ol |
| SMILES | O[C@@H](CN1CCN(C(c2ccccc2)c2ccccc2)CC1)C(F)(F)F |
| InChI | InChI=1S/C20H23F3N2O/c21-20(22,23)18(26)15-24-11-13-25(14-12-24)19(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-10,18-19,26H,11-15H2/t18-/m0/s1 |
| InChIKey | OBBIMRNLHDSSMY-SFHVURJKSA-N |
| XLogP | 3.32 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |