C13H14F3N3OS — CID 6975680
(2S)-1-(2-aminophenyl)sulfanyl-3-[3-(trifluoromethyl)pyrazol-1-yl]propan-2-ol (PubChem CID 6975680) has the molecular formula C13H14F3N3OS and a molecular weight of 317.34 g/mol. Its IUPAC name is (2S)-1-(2-aminophenyl)sulfanyl-3-[3-(trifluoromethyl)pyrazol-1-yl]propan-2-ol.
| Compound Name | (2S)-1-(2-aminophenyl)sulfanyl-3-[3-(trifluoromethyl)pyrazol-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 6975680 |
| Molecular Formula | C13H14F3N3OS |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | (2S)-1-(2-aminophenyl)sulfanyl-3-[3-(trifluoromethyl)pyrazol-1-yl]propan-2-ol |
| SMILES | Nc1ccccc1SC[C@@H](O)Cn1ccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C13H14F3N3OS/c14-13(15,16)12-5-6-19(18-12)7-9(20)8-21-11-4-2-1-3-10(11)17/h1-6,9,20H,7-8,17H2/t9-/m0/s1 |
| InChIKey | BBJRJCJRBAMNIY-VIFPVBQESA-N |
| XLogP | 2.64 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|