C23H18N2O2S — CID 6975712
(6aR,7S)-7-(4-nitrophenyl)-5,6,6a,7-tetrahydronaphtho[2,1-c][1,5]benzothiazepine (PubChem CID 6975712) has the molecular formula C23H18N2O2S and a molecular weight of 386.48 g/mol. Its IUPAC name is (6aR,7S)-7-(4-nitrophenyl)-5,6,6a,7-tetrahydronaphtho[2,1-c][1,5]benzothiazepine.
| Compound Name | (6aR,7S)-7-(4-nitrophenyl)-5,6,6a,7-tetrahydronaphtho[2,1-c][1,5]benzothiazepine |
|---|---|
| PubChem CID | 6975712 |
| Molecular Formula | C23H18N2O2S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | (6aR,7S)-7-(4-nitrophenyl)-5,6,6a,7-tetrahydronaphtho[2,1-c][1,5]benzothiazepine |
| SMILES | O=[N+]([O-])c1ccc([C@H]2Sc3ccccc3N=C3c4ccccc4CC[C@H]32)cc1 |
| InChI | InChI=1S/C23H18N2O2S/c26-25(27)17-12-9-16(10-13-17)23-19-14-11-15-5-1-2-6-18(15)22(19)24-20-7-3-4-8-21(20)28-23/h1-10,12-13,19,23H,11,14H2/t19-,23-/m1/s1 |
| InChIKey | NVTLULUUOSTOCF-AUSIDOKSSA-N |
| XLogP | 6.12 |
| TPSA | 55.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|