About dimethyl (3R)-6-(4-chlorobenzoyl)-2-phenyl-3H-pyridazine-3,4-dicarboxylate
dimethyl (3R)-6-(4-chlorobenzoyl)-2-phenyl-3H-pyridazine-3,4-dicarboxylate (PubChem CID 6975972) has the molecular formula C21H17ClN2O5
and a molecular weight of 412.83 g/mol. Its IUPAC name is dimethyl (3R)-6-(4-chlorobenzoyl)-2-phenyl-3H-pyridazine-3,4-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl (3R)-6-(4-chlorobenzoyl)-2-phenyl-3H-pyridazine-3,4-dicarboxylate |
| PubChem CID | 6975972 |
| Molecular Formula | C21H17ClN2O5 |
| Molecular Weight | 412.83 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | dimethyl (3R)-6-(4-chlorobenzoyl)-2-phenyl-3H-pyridazine-3,4-dicarboxylate |
| SMILES | COC(=O)C1=CC(C(=O)c2ccc(Cl)cc2)=NN(c2ccccc2)[C@H]1C(=O)OC |
| InChI | InChI=1S/C21H17ClN2O5/c1-28-20(26)16-12-17(19(25)13-8-10-14(22)11-9-13)23-24(18(16)21(27)29-2)15-6-4-3-5-7-15/h3-12,18H,1-2H3/t18-/m1/s1 |
| InChIKey | HJVXBYRVWJCMEK-GOSISDBHSA-N |
| XLogP | 3.04 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.83 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze dimethyl (3R)-6-(4-chlorobenzoyl)-2-phenyl-3H-pyridazine-3,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (3R)-6-(4-chlorobenzoyl)-2-phenyl-3H-pyridazine-3,4-dicarboxylate?
The IUPAC name of dimethyl (3R)-6-(4-chlorobenzoyl)-2-phenyl-3H-pyridazine-3,4-dicarboxylate (CID 6975972) is dimethyl (3R)-6-(4-chlorobenzoyl)-2-phenyl-3H-pyridazine-3,4-dicarboxylate.
What is the SMILES notation for dimethyl (3R)-6-(4-chlorobenzoyl)-2-phenyl-3H-pyridazine-3,4-dicarboxylate?
The canonical SMILES for dimethyl (3R)-6-(4-chlorobenzoyl)-2-phenyl-3H-pyridazine-3,4-dicarboxylate is COC(=O)C1=CC(C(=O)c2ccc(Cl)cc2)=NN(c2ccccc2)[C@H]1C(=O)OC.
What is the InChIKey of dimethyl (3R)-6-(4-chlorobenzoyl)-2-phenyl-3H-pyridazine-3,4-dicarboxylate?
The InChIKey is HJVXBYRVWJCMEK-GOSISDBHSA-N. The full InChI is InChI=1S/C21H17ClN2O5/c1-28-20(26)16-12-17(19(25)13-8-10-14(22)11-9-13)23-24(18(16)21(27)29-2)15-6-4-3-5-7-15/h3-12,18H,1-2H3/t18-/m1/s1.
What are the key properties of dimethyl (3R)-6-(4-chlorobenzoyl)-2-phenyl-3H-pyridazine-3,4-dicarboxylate?
dimethyl (3R)-6-(4-chlorobenzoyl)-2-phenyl-3H-pyridazine-3,4-dicarboxylate has a molecular weight of 412.83 g/mol, XLogP of 3.04, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (3R)-6-(4-chlorobenzoyl)-2-phenyl-3H-pyridazine-3,4-dicarboxylate is sourced from PubChem (CID 6975972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).