C22H20FN3O2 — CID 6976213
(3R)-1-[(4-fluorophenyl)methyl]-N-(2-methylquinolin-6-yl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 6976213) has the molecular formula C22H20FN3O2 and a molecular weight of 377.42 g/mol. Its IUPAC name is (3R)-1-[(4-fluorophenyl)methyl]-N-(2-methylquinolin-6-yl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-[(4-fluorophenyl)methyl]-N-(2-methylquinolin-6-yl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 6976213 |
| Molecular Formula | C22H20FN3O2 |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | (3R)-1-[(4-fluorophenyl)methyl]-N-(2-methylquinolin-6-yl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1ccc2cc(NC(=O)[C@@H]3CC(=O)N(Cc4ccc(F)cc4)C3)ccc2n1 |
| InChI | InChI=1S/C22H20FN3O2/c1-14-2-5-16-10-19(8-9-20(16)24-14)25-22(28)17-11-21(27)26(13-17)12-15-3-6-18(23)7-4-15/h2-10,17H,11-13H2,1H3,(H,25,28)/t17-/m1/s1 |
| InChIKey | KICGANUKTSFISL-QGZVFWFLSA-N |
| XLogP | 3.67 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |